1-[2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane structure
|
Common Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane | ||
|---|---|---|---|---|
| CAS Number | 646455-48-3 | Molecular Weight | 289.25400 | |
| Density | 1.309g/cm3 | Boiling Point | 380.3ºC at 760 mmHg | |
| Molecular Formula | C12H14F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.8ºC | |
| Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 380.3ºC at 760 mmHg |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.25400 |
| Flash Point | 183.8ºC |
| Exact Mass | 289.10400 |
| PSA | 61.09000 |
| LogP | 3.33030 |
| Index of Refraction | 1.509 |
| InChIKey | NPWQDZRJYNUBQA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCCNCC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2737N21 |
| 1-[2-nitro-4-(trifluoromethyl)phenyl]homopiperazine |