ethyl 3-(2-oxo-1H-indol-3-ylidene)propanoate structure
|
Common Name | ethyl 3-(2-oxo-1H-indol-3-ylidene)propanoate | ||
|---|---|---|---|---|
| CAS Number | 64515-46-4 | Molecular Weight | 231.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(2-oxo-1H-indol-3-ylidene)propanoate |
|---|
| Molecular Formula | C13H13NO3 |
|---|---|
| Molecular Weight | 231.24700 |
| Exact Mass | 231.09000 |
| PSA | 58.89000 |
| LogP | 2.06040 |
| InChIKey | VBRCHXDSSMSCMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC=C1C(=O)Nc2ccccc21 |
|
~%
ethyl 3-(2-oxo-... CAS#:64515-46-4 |
| Literature: Julian; Printy Journal of the American Chemical Society, 1953 , vol. 75, p. 5301,5303 |