N-(2-carboxamido-3-methoxyphenyl)-1H-tetrazole-5-carboxamide structure
|
Common Name | N-(2-carboxamido-3-methoxyphenyl)-1H-tetrazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 64470-39-9 | Molecular Weight | 576.33700 | |
| Density | 1.551g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H38I2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1-[2-[2-(3-methyl-1-azoniabicyclo[2.2.2]octan-1-yl)ethoxy]ethyl]-1-azoniabicyclo[2.2.2]octane,diiodide |
|---|
| Density | 1.551g/cm3 |
|---|---|
| Molecular Formula | C20H38I2N2O |
| Molecular Weight | 576.33700 |
| Exact Mass | 576.10700 |
| PSA | 9.23000 |
| Index of Refraction | 1.697 |
| InChIKey | PQIGONQNHPCLBB-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=O)c2nn[nH]n2)c1C(N)=O |
| HS Code | 2933990090 |
|---|
|
~81%
N-(2-carboxamid... CAS#:64470-39-9 |
| Literature: Klaubert, Dieter H.; Sellstedt, John H.; Guinosso, Charles J.; Bell, Stanley C.; Capetola, Robert J. Journal of Medicinal Chemistry, 1981 , vol. 24, # 6 p. 748 - 752 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |