4,6-bis(aziridin-1-yl)-2-naphthalen-2-yl-5-nitropyrimidine
Modify Date: 2025-11-15 21:41:23
4,6-bis(aziridin-1-yl)-2-naphthalen-2-yl-5-nitropyrimidine structure
|
Common Name | 4,6-bis(aziridin-1-yl)-2-naphthalen-2-yl-5-nitropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 64440-96-6 | Molecular Weight | 333.34400 | |
| Density | 1.48g/cm3 | Boiling Point | 497.1ºC at 760mmHg | |
| Molecular Formula | C18H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | 4,6-bis(aziridin-1-yl)-2-naphthalen-2-yl-5-nitropyrimidine |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 497.1ºC at 760mmHg |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.34400 |
| Flash Point | 254.4ºC |
| Exact Mass | 333.12300 |
| PSA | 77.62000 |
| LogP | 3.49820 |
| Index of Refraction | 1.767 |
| InChIKey | PIQSDSNCSDFCNE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(N2CC2)nc(-c2ccc3ccccc3c2)nc1N1CC1 |
|
~%
4,6-bis(aziridi... CAS#:64440-96-6 |
| Literature: Hendry; Homer Journal of the Chemical Society, 1952 , p. 328,333 |
|
~%
4,6-bis(aziridi... CAS#:64440-96-6 |
| Literature: Hendry; Homer Journal of the Chemical Society, 1952 , p. 328,333 |
![4,6-dichloro-2-[2]naphthyl-5-nitro-pyrimidine structure](https://image.chemsrc.com/caspic/420/873398-63-1.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |