Necrostatin-1
Modify Date: 2025-08-25 12:02:54
Necrostatin-1 structure
|
Common Name | Necrostatin-1 | ||
|---|---|---|---|---|
| CAS Number | 64419-92-7 | Molecular Weight | 245.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Necrostatin-1Necrostatin-1 (Nec-1) (inactive control) is an inactive analog of Necrostatin-1 (HY-15760). Necrostatin-1 is a potent necroptosis inhibitor[1]. |
| Name | 5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Necrostatin-1 (Nec-1) (inactive control) is an inactive analog of Necrostatin-1 (HY-15760). Necrostatin-1 is a potent necroptosis inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H11N3OS |
|---|---|
| Molecular Weight | 245.30000 |
| Exact Mass | 245.06200 |
| PSA | 99.54000 |
| LogP | 1.20610 |
| InChIKey | MPLRRPKKFHUEEL-UHFFFAOYSA-N |
| SMILES | O=C1NC(=S)NC1Cc1c[nH]c2ccccc12 |
|
~%
Necrostatin-1 CAS#:64419-92-7 |
| Literature: Swan Australian Journal of Scientific Research, Series A: Physical Sciences, 1952 , vol. 5, p. 728,732 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Indol-3-ylmethyl-2-thioxo-imidazolidin-4-on |
| IN1206 |
| Necrostatin-1,Inactive Control |
| 5-indol-3-ylmethyl-2-thioxo-imidazolidin-4-one |
| Thiohydantoin-Try |
| Tryptophanthiohydantoin |
| Nec-1i |
| tryptophan 2-thiohydantoin |