4H-[1,3]Thiazino[3,2-a]benzimidazol-4-one,2-methyl- structure
|
Common Name | 4H-[1,3]Thiazino[3,2-a]benzimidazol-4-one,2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 64411-76-3 | Molecular Weight | 216.25900 | |
| Density | 1.43g/cm3 | Boiling Point | 490ºC at 760mmHg | |
| Molecular Formula | C11H8N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1ºC | |
| Name | 2-methyl-[1,3]thiazino[3,2-a]benzimidazol-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 490ºC at 760mmHg |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.25900 |
| Flash Point | 250.1ºC |
| Exact Mass | 216.03600 |
| PSA | 62.61000 |
| LogP | 2.21760 |
| Index of Refraction | 1.745 |
| InChIKey | XMOVWCGYIZUIIG-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n2c(nc3ccccc32)s1 |
|
~%
4H-[1,3]Thiazin... CAS#:64411-76-3 |
| Literature: Liu; Taun; Shih; Lee Archiv der Pharmazie, 1977 , vol. 310, # 6 p. 522 - 524 |
|
~3%
4H-[1,3]Thiazin... CAS#:64411-76-3 |
| Literature: Sakamoto, Masanori; Akimoto, Takashi; Fukutomi, Kyoko; Ishii, Keitaro Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2516 - 2521 |
| 2-methyl-benzo[4,5]imidazo[2,1-b][1,3]thiazin-4-one |
| 2-methyl-4H-<1,3>thiazino<3,2-a>benzimidazol-4-one |