4-(aziridin-1-yl)-6-chloro-2-(4-methoxyphenyl)pyrimidine structure
|
Common Name | 4-(aziridin-1-yl)-6-chloro-2-(4-methoxyphenyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 64398-21-6 | Molecular Weight | 261.70700 | |
| Density | 1.334g/cm3 | Boiling Point | 337.3ºC at 760mmHg | |
| Molecular Formula | C13H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | 4-(aziridin-1-yl)-6-chloro-2-(4-methoxyphenyl)pyrimidine |
|---|
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 337.3ºC at 760mmHg |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.70700 |
| Flash Point | 157.8ºC |
| Exact Mass | 261.06700 |
| PSA | 38.02000 |
| LogP | 2.69060 |
| Index of Refraction | 1.627 |
| InChIKey | DHJLBIPMCYGKMZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(Cl)cc(N3CC3)n2)cc1 |
|
~%
4-(aziridin-1-y... CAS#:64398-21-6 |
| Literature: Hendry; Homer Journal of the Chemical Society, 1952 , p. 328,333 |
|
~%
4-(aziridin-1-y... CAS#:64398-21-6 |
| Literature: Hendry; Homer Journal of the Chemical Society, 1952 , p. 328,333 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |