1-cyclopropyl-3-(3,4-dichlorophenyl)urea
Modify Date: 2025-09-21 20:24:32
1-cyclopropyl-3-(3,4-dichlorophenyl)urea structure
|
Common Name | 1-cyclopropyl-3-(3,4-dichlorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 64393-09-5 | Molecular Weight | 245.10500 | |
| Density | 1.42g/cm3 | Boiling Point | 339.2ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9ºC | |
| Name | 1-cyclopropyl-3-(3,4-dichlorophenyl)urea |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 339.2ºC at 760 mmHg |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.10500 |
| Flash Point | 158.9ºC |
| Exact Mass | 244.01700 |
| PSA | 41.13000 |
| LogP | 3.74120 |
| Index of Refraction | 1.616 |
| InChIKey | NLYIKMDIDIXUAH-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NC1CC1 |
| HS Code | 2924299090 |
|---|
|
~%
1-cyclopropyl-3... CAS#:64393-09-5 |
| Literature: Schering Patent: FR2335497DE2558078 , 19771977 ; Chem.Abstr., 1977 , vol. 87, # 167773 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |