CHEMBRDG-BB 5796119
Modify Date: 2025-08-27 16:42:23
CHEMBRDG-BB 5796119 structure
|
Common Name | CHEMBRDG-BB 5796119 | ||
|---|---|---|---|---|
| CAS Number | 64375-69-5 | Molecular Weight | 282.16500 | |
| Density | 1.283g/cm3 | Boiling Point | 393.7ºC at 760 mmHg | |
| Molecular Formula | C14H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | 4-(4,8-dichloro-2-methylquinolin-3-yl)butan-2-one |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760 mmHg |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.16500 |
| Flash Point | 191.9ºC |
| Exact Mass | 281.03700 |
| PSA | 29.96000 |
| LogP | 4.37160 |
| Index of Refraction | 1.604 |
| InChIKey | MOKWWJGOBBVWHO-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1c(C)nc2c(Cl)cccc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |