(4-chlorophenyl)-(4-propylphenyl)methanone
Modify Date: 2025-08-24 18:21:04
(4-chlorophenyl)-(4-propylphenyl)methanone structure
|
Common Name | (4-chlorophenyl)-(4-propylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 64357-63-7 | Molecular Weight | 258.74300 | |
| Density | 1.13g/cm3 | Boiling Point | 380.4ºC at 760 mmHg | |
| Molecular Formula | C16H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | (4-chlorophenyl)-(4-propylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 380.4ºC at 760 mmHg |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.74300 |
| Flash Point | 222.4ºC |
| Exact Mass | 258.08100 |
| PSA | 17.07000 |
| LogP | 4.52350 |
| Index of Refraction | 1.57 |
| InChIKey | MCLQRYGTVPTHDY-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
(4-chlorophenyl... CAS#:64357-63-7 |
| Literature: Xuong; Buu-Hoi Journal of the Chemical Society, 1952 , p. 3741,3744 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-chloro-4'-propyl-benzophenone |
| 4-Chlor-4'-propyl-benzophenon |
| 4-Chloro-4'-n-propylbenzophenone |
| (4-chlorophenyl)(4-propylphenyl)methanone |