3-(4-METHYLPHENYL)-1H-1,2,4-TRIAZOLE-5-THIOL structure
|
Common Name | 3-(4-METHYLPHENYL)-1H-1,2,4-TRIAZOLE-5-THIOL | ||
|---|---|---|---|---|
| CAS Number | 64310-34-5 | Molecular Weight | 191.25300 | |
| Density | 1.34g/cm3 | Boiling Point | 282.1ºC at 760 mmHg | |
| Molecular Formula | C9H9N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.4ºC | |
| Name | N-(2-chloroethyl)quinolin-2-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 282.1ºC at 760 mmHg |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.25300 |
| Flash Point | 124.4ºC |
| Exact Mass | 191.05200 |
| PSA | 80.37000 |
| LogP | 2.06880 |
| Index of Refraction | 1.703 |
| InChIKey | DEVMOFPQIPHPDM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(=S)[nH][nH]2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Mercapto-3-p-tolyl-s-triazole |
| TL 1120 |