1-PHENYLBUT-3-YN-2-AMINE
Modify Date: 2025-08-25 11:11:23
1-PHENYLBUT-3-YN-2-AMINE structure
|
Common Name | 1-PHENYLBUT-3-YN-2-AMINE | ||
|---|---|---|---|---|
| CAS Number | 6431-57-8 | Molecular Weight | 370.40200 | |
| Density | 1.31g/cm3 | Boiling Point | 490ºC at 760 mmHg | |
| Molecular Formula | C19H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.2ºC | |
| Name | methyl 1-(3-ethoxypropyl)-2-imino-10-methyl-5-oxodipyrido[3,4-c:1',2'-f]pyrimidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 490ºC at 760 mmHg |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.40200 |
| Flash Point | 250.2ºC |
| Exact Mass | 370.16400 |
| PSA | 98.68000 |
| LogP | 1.75000 |
| Index of Refraction | 1.624 |
| InChIKey | PVERQYSXWWUBHI-UHFFFAOYSA-N |
| SMILES | CCOCCCn1c(=N)c(C(=O)OC)cc2c(=O)n3cccc(C)c3nc21 |
|
~%
1-PHENYLBUT-3-Y... CAS#:6431-57-8 |
| Literature: Burger; Zimmerman; Ariens Journal of medicinal chemistry, 1966 , vol. 9, # 4 p. 469 - 470 |
| 1-Ethynylphenethylamin |