Nigrolineaxanthone S
Modify Date: 2026-06-14 11:27:19
Nigrolineaxanthone S structure
|
Common Name | Nigrolineaxanthone S | ||
|---|---|---|---|---|
| CAS Number | 643026-20-4 | Molecular Weight | 446.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Nigrolineaxanthone S |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H30O5 |
|---|---|
| Molecular Weight | 446.5 |
| InChIKey | RBHZFZSVMMGEQW-VCHYOVAHSA-N |
| SMILES | CC(=CCC/C(=C/CCC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)C=CC=C4O)O)C)/C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antibacterial activity against methicillin-resistant Staphylococcus aureus after 18 h...
Source: ChEMBL
Target: Staphylococcus aureus
External Id: CHEMBL989454
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Nigrolineaxanthone S? |
| A: The English name of Nigrolineaxanthone S is Nigrolineaxanthone S. |
| Q: What is the Chinese name of 643026-20-4? |
| A: Chinese name of 643026-20-4 is 643026-20-4. |
| Q: What is the molecular weight of Nigrolineaxanthone S? |
| A: Molecular weight of Nigrolineaxanthone S is 446.5. |
| Q: What is the CAS number of Nigrolineaxanthone S? |
| A: CAS number of Nigrolineaxanthone S is 643026-20-4. |
| Q: What is the molecular formula of Nigrolineaxanthone S? |
| A: Molecular formula of Nigrolineaxanthone S is C28H30O5. |
| Q: What is the InChIKey of Nigrolineaxanthone S? |
| A: InChIKey of Nigrolineaxanthone S is RBHZFZSVMMGEQW-VCHYOVAHSA-N. |
| Q: What is the SMILES notation of Nigrolineaxanthone S? |
| A: SMILES notation of Nigrolineaxanthone S is CC(=CCC/C(=C/CCC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)C=CC=C4O)O)C)/C)C. |