4aH-benzo[3,4]cyclobuta[1,2-d][1,3]thiazine-2,4-dithione structure
|
Common Name | 4aH-benzo[3,4]cyclobuta[1,2-d][1,3]thiazine-2,4-dithione | ||
|---|---|---|---|---|
| CAS Number | 64247-60-5 | Molecular Weight | 235.34800 | |
| Density | 1.62g/cm3 | Boiling Point | 366.6ºC at 760 mmHg | |
| Molecular Formula | C10H5NS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.5ºC | |
| Name | 4aH-benzo[3,4]cyclobuta[1,2-d][1,3]thiazine-2,4-dithione |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 366.6ºC at 760 mmHg |
| Molecular Formula | C10H5NS3 |
| Molecular Weight | 235.34800 |
| Flash Point | 175.5ºC |
| Exact Mass | 234.95800 |
| PSA | 101.84000 |
| LogP | 2.36760 |
| Index of Refraction | 1.885 |
| InChIKey | YGOPPQFZAXLXBR-UHFFFAOYSA-N |
| SMILES | S=C1N=C2c3ccccc3C2C(=S)S1 |
|
~%
4aH-benzo[3,4]c... CAS#:64247-60-5 |
| Literature: Muraoka,M. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1273 - 1280 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |