(Z)-2'-(1H-Imidazole-1-yl)-2,4-dichloroacetophenone oxime structure
|
Common Name | (Z)-2'-(1H-Imidazole-1-yl)-2,4-dichloroacetophenone oxime | ||
|---|---|---|---|---|
| CAS Number | 64211-06-9 | Molecular Weight | 270.115 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 469.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.9±25.9 °C | |
| Name | (NZ)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.7±35.0 °C at 760 mmHg |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.115 |
| Flash Point | 237.9±25.9 °C |
| Exact Mass | 269.012268 |
| PSA | 50.41000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | WDFDJSRQMAZXEJ-PTNGSMBKSA-N |
| SMILES | ON=C(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| HS Code | 2933290090 |
|---|
|
~%
Detail
|
| Literature: US4443612 A1, ; |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (1Z)-1-(2,4-Dichlorphenyl)-2-(1H-imidazol-1-yl)ethanonoxim |
| Ethanone, 2-chloro-1-[2-(4-chloro-1H-imidazol-1-yl)phenyl]-, oxime, (1Z)- |
| Ethanone, 1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)-, oxime, (1Z)- |
| (1Z)-2-Chloro-1-[2-(4-chloro-1H-imidazol-1-yl)phenyl]-N-hydroxyethanimine |
| (Z)-2'-(1H-imidazl-1-yl)-2,4-dichloroacetophenone oxime |
| (1Z)-1-(2,4-Dichlorophenyl)-N-hydroxy-2-(1H-imidazol-1-yl)ethanimine |