2-(3,4-dihydroxyphenyl)-5,6,7-trihydroxy-3-methoxychromen-4-one
Modify Date: 2025-10-15 18:34:36
2-(3,4-dihydroxyphenyl)-5,6,7-trihydroxy-3-methoxychromen-4-one structure
|
Common Name | 2-(3,4-dihydroxyphenyl)-5,6,7-trihydroxy-3-methoxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 64190-88-1 | Molecular Weight | 332.26200 | |
| Density | 1.8g/cm3 | Boiling Point | 727.2ºC at 760mmHg | |
| Molecular Formula | C16H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.8ºC | |
| Name | 2-(3,4-dihydroxyphenyl)-5,6,7-trihydroxy-3-methoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8g/cm3 |
|---|---|
| Boiling Point | 727.2ºC at 760mmHg |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26200 |
| Flash Point | 274.8ºC |
| Exact Mass | 332.05300 |
| PSA | 140.59000 |
| LogP | 1.99660 |
| Index of Refraction | 1.8 |
| InChIKey | QZAXKZRZMAXPSF-UHFFFAOYSA-N |
| SMILES | COc1c(-c2ccc(O)c(O)c2)oc2cc(O)c(O)c(O)c2c1=O |
|
~%
2-(3,4-dihydrox... CAS#:64190-88-1 |
| Literature: Horie; Tominaga; Yoshida; Kawamura Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 3 p. 877 - 881 |
| 3',4',5,6,7-Pentahydroxy-3-methoxyflavone |
| quercetin-3-methyl ether |
| quercetagetin-3-methyl ether |