sar chelate structure
|
Common Name | sar chelate | ||
|---|---|---|---|---|
| CAS Number | 64189-50-0 | Molecular Weight | 284.44400 | |
| Density | 0.911g/cm3 | Boiling Point | 469.4ºC at 760 mmHg | |
| Molecular Formula | C14H32N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.3ºC | |
| Name | 3,6,10,13,16,19-hexazabicyclo[6.6.6]icosane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.911g/cm3 |
|---|---|
| Boiling Point | 469.4ºC at 760 mmHg |
| Molecular Formula | C14H32N6 |
| Molecular Weight | 284.44400 |
| Flash Point | 256.3ºC |
| Exact Mass | 284.26900 |
| PSA | 72.18000 |
| Index of Refraction | 1.442 |
| InChIKey | NVOVSXGZALWAFS-UHFFFAOYSA-N |
| SMILES | C1CNCC2CNCCNCC(CN1)CNCCNC2 |
| HS Code | 2902199090 |
|---|
| HS Code | 2902199090 |
|---|---|
| Summary | 2902199090 other cyclanes, cyclenes and cyclotherpenes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| Sar |
| Sar chelate |
| Sarcophagine |