N-[(Benzyloxy)carbonyl]glycine ethenyl ester structure
|
Common Name | N-[(Benzyloxy)carbonyl]glycine ethenyl ester | ||
|---|---|---|---|---|
| CAS Number | 64187-24-2 | Molecular Weight | 235.23600 | |
| Density | 1.181g/cm3 | Boiling Point | 371.5ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | ethenyl 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 371.5ºC at 760 mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 178.5ºC |
| Exact Mass | 235.08400 |
| PSA | 68.12000 |
| LogP | 1.80390 |
| Index of Refraction | 1.526 |
| InChIKey | JYKQZYMZPYYHLX-UHFFFAOYSA-N |
| SMILES | C=COC(=O)CNC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Carbobenzoxyglycine vinyl ester |
| Glycine,N-benzyloxycarbonyl-,vinyl ester,L |