Benzenesulfonamide,4-methyl-N-[(4-methylphenyl)sulfonyl]-N-(2-phenylethyl)- structure
|
Common Name | Benzenesulfonamide,4-methyl-N-[(4-methylphenyl)sulfonyl]-N-(2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 64183-77-3 | Molecular Weight | 429.55200 | |
| Density | 1.284g/cm3 | Boiling Point | 595.4ºC at 760mmHg | |
| Molecular Formula | C22H23NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.9ºC | |
| Name | 4-methyl-N-(4-methylphenyl)sulfonyl-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 595.4ºC at 760mmHg |
| Molecular Formula | C22H23NO4S2 |
| Molecular Weight | 429.55200 |
| Flash Point | 313.9ºC |
| Exact Mass | 429.10700 |
| PSA | 88.28000 |
| LogP | 6.08730 |
| Index of Refraction | 1.611 |
| InChIKey | RWIGLZMDSKKXJN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(CCc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
|
~%
Benzenesulfonam... CAS#:64183-77-3 |
| Literature: Carothers; Bickford; Hurwitz Journal of the American Chemical Society, 1927 , vol. 49, p. 2908 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methyl-N-(4-methylphenyl)sulfonyl-N-phenethylbenzenesulfonamide |
| phenethyl-bis-(toluene-4-sulfonyl)-amine |
| Phenaethyl-bis-(toluol-4-sulfonyl)-amin |