trimethylammonium 2,4-dichlorophenoxyacetate
Modify Date: 2025-11-26 17:39:10
trimethylammonium 2,4-dichlorophenoxyacetate structure
|
Common Name | trimethylammonium 2,4-dichlorophenoxyacetate | ||
|---|---|---|---|---|
| CAS Number | 6416-73-5 | Molecular Weight | 280.14800 | |
| Density | N/A | Boiling Point | 345.6ºC at 760 mmHg | |
| Molecular Formula | C11H15Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | (2,4-Dichlorophenoxy)acetic acid-N,N-dimethylmethanamine (1:1) |
|---|
| Boiling Point | 345.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.14800 |
| Flash Point | 162.8ºC |
| Exact Mass | 279.04300 |
| PSA | 49.77000 |
| LogP | 2.63460 |
| InChIKey | ZRRWVAQQSHSQOM-UHFFFAOYSA-N |
| SMILES | CN(C)C.O=C(O)COc1ccc(Cl)cc1Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |