Tracid Brilliant Red B
Modify Date: 2025-08-26 17:02:23
Tracid Brilliant Red B structure
|
Common Name | Tracid Brilliant Red B | ||
|---|---|---|---|---|
| CAS Number | 6416-66-6 | Molecular Weight | 748.111 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H20ClN3Na2O10S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tracid Brilliant Red BAcid Red 249 (Tracid Brilliant Red B) is a kind of weak acid dye containing sulfate ion[1]. |
| Name | disodium,(3Z)-3-[(5-chloro-2-phenoxyphenyl)hydrazinylidene]-5-[(4-methylphenyl)sulfonylamino]-4-oxonaphthalene-2,7-disulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Acid Red 249 (Tracid Brilliant Red B) is a kind of weak acid dye containing sulfate ion[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H20ClN3Na2O10S3 |
|---|---|
| Molecular Weight | 748.111 |
| Exact Mass | 746.979492 |
| PSA | 239.89000 |
| LogP | 9.63930 |
| InChIKey | XDBZPHDFHYZHNG-UHFFFAOYSA-L |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])c(N=Nc4cc(Cl)ccc4Oc4ccccc4)c(O)c23)cc1.[Na+].[Na+] |
| 2,7-Naphthalenedisulfonic acid, 3-[2-(5-chloro-2-phenoxyphenyl)diazenyl]-4-hydroxy-5-[[(4-methylphenyl)sulfonyl]amino]-, sodium salt (1:2) |
| Disodium 3-[(5-chloro-2-phenoxyphenyl)diazenyl]-4-hydroxy-5-{[(4-methylphenyl)sulfonyl]amino}-2,7-naphthalenedisulfonate |
| Disodium 3-[(5-chloro-2-phenoxyphenyl)diazenyl]-4-hydroxy-5-{[(4-methylphenyl)sulfonyl]amino}naphthalene-2,7-disulfonate |