(2,5-dioxopyrrolidin-1-yl) 2-(methylamino)benzoate structure
|
Common Name | (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 64156-72-5 | Molecular Weight | 248.23500 | |
| Density | 1.37g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | (2,5-dioxopyrrolidin-1-yl) 2-(methylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.23500 |
| Flash Point | 206ºC |
| Exact Mass | 248.08000 |
| PSA | 75.71000 |
| LogP | 0.96000 |
| Index of Refraction | 1.601 |
| InChIKey | UNICSTUDFDPGRF-UHFFFAOYSA-N |
| SMILES | CNc1ccccc1C(=O)ON1C(=O)CCC1=O |
| HS Code | 2925190090 |
|---|
|
~88%
(2,5-dioxopyrro... CAS#:64156-72-5 |
| Literature: Mitsos, Christos; Zografos, Alexandros; Igglessi-Markopoulou, Olga Chemical and Pharmaceutical Bulletin, 2000 , vol. 48, # 2 p. 211 - 214 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Succinimidyl N-methylanthranilate |
| 2-methylaminobenzoic acid 2,5-dioxopyrrolidin-1-yl ester |
| N-methyl anthranilic acid succinimidyl ester |