Solvent Blue 63
Modify Date: 2025-08-27 16:26:43
Solvent Blue 63 structure
|
Common Name | Solvent Blue 63 | ||
|---|---|---|---|---|
| CAS Number | 6408-50-0 | Molecular Weight | 342.39100 | |
| Density | 1.312 g/cm3 | Boiling Point | 566.4ºC at 760 mmHg | |
| Molecular Formula | C22H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(methylamino)-4-(3-methylanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312 g/cm3 |
|---|---|
| Boiling Point | 566.4ºC at 760 mmHg |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.39100 |
| Exact Mass | 342.13700 |
| PSA | 58.20000 |
| LogP | 4.70170 |
| Index of Refraction | 1.715 |
| InChIKey | GBAJQXFGDKEDBM-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Nc2cccc(C)c2)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ceres Blue GN |
| 1-(methylamino)-4-[(3-methylphenyl)amino]anthraquinone |
| Anthraquinone,1-(methylamino)-4-m-toluidino |
| C.I. Solvent Blue 63 |
| Sudan Blue GN |
| Solvent Blue 63 |
| MFCD00802556 |