2-(2-acetamidophenyl)sulfanylethyl-diethyl-methylazanium,iodide structure
|
Common Name | 2-(2-acetamidophenyl)sulfanylethyl-diethyl-methylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 64070-80-0 | Molecular Weight | 408.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25IN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-acetamidophenyl)sulfanylethyl-diethyl-methylazanium,iodide |
|---|
| Molecular Formula | C15H25IN2OS |
|---|---|
| Molecular Weight | 408.34100 |
| Exact Mass | 408.07300 |
| PSA | 60.72000 |
| LogP | 4.74370 |
| InChIKey | WJCBTRXULGGMSI-UHFFFAOYSA-N |
| SMILES | CC[N+](C)(CC)CCSc1ccccc1NC(C)=O.[I-] |
|
~%
2-(2-acetamidop... CAS#:64070-80-0 |
| Literature: Schuetz; Baldwin Journal of the American Chemical Society, 1958 , vol. 80, p. 162 |