[4-chloro-3-(methylcarbamoyloxy)phenyl]-dimethylazanium,chloride structure
|
Common Name | [4-chloro-3-(methylcarbamoyloxy)phenyl]-dimethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 64059-13-8 | Molecular Weight | 265.13600 | |
| Density | N/A | Boiling Point | 337.9ºC at 760mmHg | |
| Molecular Formula | C10H14Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | [4-chloro-3-(methylcarbamoyloxy)phenyl]-dimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 337.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H14Cl2N2O2 |
| Molecular Weight | 265.13600 |
| Flash Point | 158.1ºC |
| Exact Mass | 264.04300 |
| PSA | 45.06000 |
| LogP | 3.13060 |
| InChIKey | MNPOKKCRDILHFA-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc([NH+](C)C)ccc1Cl.[Cl-] |
| T-1842 |
| N-Methylurethane of hydrochloride of 6-chloro-3-dimethylaminophenol |
| Carbamic acid,N-methyl-,2-chloro-5-dimethylaminophenyl ester,hydrochloride |