[3-(benzylcarbamoyloxy)phenyl]-trimethylazanium,iodide structure
|
Common Name | [3-(benzylcarbamoyloxy)phenyl]-trimethylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 64051-08-7 | Molecular Weight | 412.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(benzylcarbamoyloxy)phenyl]-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21IN2O2 |
|---|---|
| Molecular Weight | 412.26500 |
| Exact Mass | 412.06500 |
| PSA | 44.65000 |
| LogP | 4.24700 |
| InChIKey | JEVBAXFLZYJPGN-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)c1cccc(OC(=O)NCc2ccccc2)c1.[I-] |
| HS Code | 2924299090 |
|---|
|
~%
[3-(benzylcarba... CAS#:64051-08-7 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| T-1125 |
| Carbamic acid,N-benzyl-,3-dimethylaminophenyl ester,methiodide |
| Methiodide of N-benzylurethane of 3-dimethylaminophenol |
| 3-Benzylcarbamoyloxy-tri-N-methyl-anilinium,Jodid |
| 3-benzylcarbamoyloxy-tri-N-methyl-anilinium,iodide |