2-Propenoic acid,2-[2,4-bis(1,1-dimethylpropyl)phenoxy]ethyl ester structure
|
Common Name | 2-Propenoic acid,2-[2,4-bis(1,1-dimethylpropyl)phenoxy]ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 64050-16-4 | Molecular Weight | 332.47700 | |
| Density | 0.965g/cm3 | Boiling Point | 417.5ºC at 760 mmHg | |
| Molecular Formula | C21H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.4ºC | |
| Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760 mmHg |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.47700 |
| Flash Point | 177.4ºC |
| Exact Mass | 332.23500 |
| PSA | 35.53000 |
| LogP | 5.16980 |
| Index of Refraction | 1.486 |
| InChIKey | MMXPBYQIASNXFL-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| HS Code | 2916129000 |
|---|
|
~%
2-Propenoic aci... CAS#:64050-16-4 |
| Literature: Rehberg; Faucette Journal of Organic Chemistry, 1949 , vol. 14, p. 1094,1095, 1097 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Acrylic acid 2-[2,4-bis(1,1-dimethylpropyl)phenoxy]ethyl ester |
| 1-Acryloyloxy-2-(2,4-di-tert-pentyl-phenoxy)-aethan |
| Acrylsaeure-[2-(2.4-di-tert.-pentyl-phenoxy)-aethylester] |
| Einecs 264-620-5 |
| 2-(2,4-bis(1,1-dimethylpropyl)phenoxy)ethyl acrylate |
| 1-acryloyloxy-2-(2,4-di-tert-pentyl-phenoxy)-ethane |