3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl chloride structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl chloride | ||
|---|---|---|---|---|
| CAS Number | 64018-25-3 | Molecular Weight | 382.55000 | |
| Density | 1.573g/cm3 | Boiling Point | 165ºC at 760 mmHg | |
| Molecular Formula | C8H4ClF13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 78.2ºC | |
| Name | 8-chloro-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 165ºC at 760 mmHg |
| Molecular Formula | C8H4ClF13 |
| Molecular Weight | 382.55000 |
| Flash Point | 78.2ºC |
| Exact Mass | 381.97900 |
| LogP | 5.35410 |
| Index of Refraction | 1.303 |
| InChIKey | TYIZCYGZKIZQIH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCl |
| HS Code | 2915900090 |
|---|
|
~97%
3,3,4,4,5,5,6,6... CAS#:64018-25-3 |
| Literature: Dobbs, Adrian P.; Penny, Mark J.; Jones, Peter Tetrahedron Letters, 2008 , vol. 49, # 49 p. 6955 - 6958 |
|
~%
3,3,4,4,5,5,6,6... CAS#:64018-25-3 |
| Literature: Wrackmeyer, Bernd; Werner, Konrad Von; Wehowsky, Frank Journal of Fluorine Chemistry, 1987 , vol. 35, p. 359 - 372 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2-perfluorohexyl ethanoyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoyl chloride |
| EINECS 264-606-9 |
| n-perfluorohexyl acetyl chloride |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl chloride |