2-[[5-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid structure
|
Common Name | 2-[[5-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 64013-61-2 | Molecular Weight | 369.43700 | |
| Density | 1.28g/cm3 | Boiling Point | 611.3ºC at 760 mmHg | |
| Molecular Formula | C19H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.5ºC | |
| Name | 2-[[5-[(2,6-dimethylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 611.3ºC at 760 mmHg |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.43700 |
| Flash Point | 323.5ºC |
| Exact Mass | 369.11500 |
| PSA | 102.54000 |
| LogP | 3.63980 |
| Index of Refraction | 1.637 |
| InChIKey | HWWPQIBEGXKCRW-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1OCc1nnc(SCC(=O)O)n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |