5-oxo-1-phenyl-2-pyrazoline-3-carboxamide
Modify Date: 2025-09-02 19:32:07
5-oxo-1-phenyl-2-pyrazoline-3-carboxamide structure
|
Common Name | 5-oxo-1-phenyl-2-pyrazoline-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6401-98-5 | Molecular Weight | 203.19700 | |
| Density | 1.41g/cm3 | Boiling Point | 361ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | [3-(benzenesulfonyloxy)-6-sulfamoylnaphthalen-2-yl] benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 361ºC at 760 mmHg |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.19700 |
| Flash Point | 172.2ºC |
| Exact Mass | 203.06900 |
| PSA | 75.76000 |
| LogP | 0.46550 |
| Index of Refraction | 1.679 |
| InChIKey | SPFXLCCBWAJCHQ-UHFFFAOYSA-N |
| SMILES | NC(=O)C1=NN(c2ccccc2)C(=O)C1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-Bis((phenylsulphonyl)oxy)naphthalene-2-sulphonamide |
| 6-sulfamoylnaphthalene-2,3-diyl dibenzenesulfonate |
| 2-Naphthalenesulfonamide,6,7-bis((phenylsulfonyl)oxy) |
| EINECS 264-029-2 |
| 6,7-Dihydroxy-2-naphthalenesulfonamide,dibenzenesulfonate |