3-(benzylamino)-5-(4-methylphenyl)cyclohex-2-en-1-one
Modify Date: 2025-10-12 09:27:16
3-(benzylamino)-5-(4-methylphenyl)cyclohex-2-en-1-one structure
|
Common Name | 3-(benzylamino)-5-(4-methylphenyl)cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 6401-56-5 | Molecular Weight | 291.38700 | |
| Density | 1.11g/cm3 | Boiling Point | 466.9ºC at 760 mmHg | |
| Molecular Formula | C20H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 3-(benzylamino)-5-(4-methylphenyl)cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 466.9ºC at 760 mmHg |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.38700 |
| Flash Point | 161.9ºC |
| Exact Mass | 291.16200 |
| PSA | 29.10000 |
| LogP | 4.50610 |
| Index of Refraction | 1.606 |
| InChIKey | HBSBPHPQSGPPRW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2CC(=O)C=C(NCc3ccccc3)C2)cc1 |
|
~91%
3-(benzylamino)... CAS#:6401-56-5 |
| Literature: Deska, Jan; Kazmaier, Uli Chemistry - A European Journal, 2007 , vol. 13, # 21 p. 6204 - 6211 |
|
~%
3-(benzylamino)... CAS#:6401-56-5 |
| Literature: Bespalova, Zhanna D.; Pekelis, Boris L.; Deigin, Vladislav I.; Yarova, Elena P.; Saks, Tatyana P.; et al. Collection of Czechoslovak Chemical Communications, 1990 , vol. 55, # 10 p. 2537 - 2554 |
| carbobenzoxy-L-leucylglycine t-butyl ester |
| Z-Leu-Gly-OtBu |
| HMS2794K24 |
| 3-Benzylamino-5-p-tolyl-cyclohex-2-enone |
| Z-Leu-Gly-OBut |