ethyl-dimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,iodide structure
|
Common Name | ethyl-dimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 63981-97-5 | Molecular Weight | 350.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl-dimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19IN2O2 |
|---|---|
| Molecular Weight | 350.19600 |
| Exact Mass | 350.04900 |
| PSA | 44.65000 |
| LogP | 3.06670 |
| InChIKey | JABYKLLZSMHVBH-UHFFFAOYSA-N |
| SMILES | CC[N+](C)(C)c1cccc(OC(=O)NC)c1.[I-] |
|
~%
ethyl-dimethyl-... CAS#:63981-97-5 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| N-Aethyl-N,N-dimethyl-3-methylcarbamoyloxy-anilinium,Jodid |
| Ethiodide of N-methylurethane of 3-dimethylaminophenol |
| Carbamic acid,N-methyl-,3-dimethylaminophenyl ester,ethiodide |
| N-ethyl-N,N-dimethyl-3-methylcarbamoyloxy-anilinium,iodide |
| TL-1323 |
| T-1194 |