[4-chloro-3-(methylcarbamoyloxy)phenyl]-trimethylazanium,iodide
Modify Date: 2024-09-10 20:13:53
![[4-chloro-3-(methylcarbamoyloxy)phenyl]-trimethylazanium,iodide Structure](https://image.chemsrc.com/caspic/495/63981-88-4.png)
[4-chloro-3-(methylcarbamoyloxy)phenyl]-trimethylazanium,iodide structure
|
Common Name | [4-chloro-3-(methylcarbamoyloxy)phenyl]-trimethylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 63981-88-4 | Molecular Weight | 370.61400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClIN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-chloro-3-(methylcarbamoyloxy)phenyl]-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16ClIN2O2 |
|---|---|
| Molecular Weight | 370.61400 |
| Exact Mass | 369.99500 |
| PSA | 44.65000 |
| LogP | 3.33000 |
| InChIKey | SPLLMWUMIKAOIJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc([N+](C)(C)C)ccc1Cl.[I-] |
|
~%
[4-chloro-3-(me... CAS#:63981-88-4 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| 4-chloro-tri-N-methyl-3-methylcarbamoyloxy-anilinium,iodide |
| 4-Chlor-tri-N-methyl-3-methylcarbamoyloxy-anilinium,Jodid |
| T-1800 |
| Carbamic acid,N-methyl-,2-chloro-5-dimethylaminophenyl ester,methiodide |