[3-(dimethylcarbamoyloxy)-2-methyl-5-propan-2-ylphenyl]-trimethylazanium,iodide
Modify Date: 2025-09-20 16:28:57
![[3-(dimethylcarbamoyloxy)-2-methyl-5-propan-2-ylphenyl]-trimethylazanium,iodide Structure](https://image.chemsrc.com/caspic/071/63981-86-2.png)
[3-(dimethylcarbamoyloxy)-2-methyl-5-propan-2-ylphenyl]-trimethylazanium,iodide structure
|
Common Name | [3-(dimethylcarbamoyloxy)-2-methyl-5-propan-2-ylphenyl]-trimethylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 63981-86-2 | Molecular Weight | 406.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(dimethylcarbamoyloxy)-2-methyl-5-propan-2-ylphenyl]-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H27IN2O2 |
|---|---|
| Molecular Weight | 406.30200 |
| Exact Mass | 406.11200 |
| PSA | 29.54000 |
| LogP | 0.37950 |
| InChIKey | OWBMIRJXYXGPCS-UHFFFAOYSA-M |
| SMILES | Cc1c(OC(=O)N(C)C)cc(C(C)C)cc1[N+](C)(C)C.[I-] |
|
~%
[3-(dimethylcar... CAS#:63981-86-2 |
| Literature: Stevens; Beutel Journal of the American Chemical Society, 1941 , vol. 63, p. 308,309 |
|
~%
[3-(dimethylcar... CAS#:63981-86-2 |
| Literature: Stevens; Beutel Journal of the American Chemical Society, 1941 , vol. 63, p. 308,309 |
| Carbamic acid,N,N-dimethyl-,4-dimethylaminothymyl ester,methiodide |
| 4-Dimethylcarbamoyloxy-5-isopropyl-2,N,N,N-tetramethyl-anilinium,Jodid |
| SB-10 |
| 4-dimethylcarbamoyloxy-5-isopropyl-2,N,N,N-tetramethyl-anilinium,iodide |