trimethyl-[2-(prop-2-enylcarbamoyloxy)ethyl]azanium,chloride structure
|
Common Name | trimethyl-[2-(prop-2-enylcarbamoyloxy)ethyl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63981-50-0 | Molecular Weight | 222.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2-(prop-2-enylcarbamoyloxy)ethyl]azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H19ClN2O2 |
|---|---|
| Molecular Weight | 222.71200 |
| Exact Mass | 222.11400 |
| PSA | 44.65000 |
| LogP | 1.48370 |
| InChIKey | YLSSDTLINWPQKJ-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)OCC[N+](C)(C)C.[Cl-] |
|
~%
trimethyl-[2-(p... CAS#:63981-50-0 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| Carbamic acid,N-allyl-,2-dimethylaminoethyl ester,methochloride |