Ethanedioicacid, 1,2-bis[2-[(2-hydroxy-1-naphthalenyl)methylene]hydrazide] structure
|
Common Name | Ethanedioicacid, 1,2-bis[2-[(2-hydroxy-1-naphthalenyl)methylene]hydrazide] | ||
|---|---|---|---|---|
| CAS Number | 63968-59-2 | Molecular Weight | 426.42400 | |
| Density | 1.483g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N',2-N'-bis[(Z)-(2-oxonaphthalen-1-ylidene)methyl]ethanedihydrazide |
|---|
| Density | 1.483g/cm3 |
|---|---|
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.42400 |
| Exact Mass | 426.13300 |
| PSA | 123.38000 |
| LogP | 3.78640 |
| Index of Refraction | 1.772 |
| InChIKey | QWOVWBVVPLQBLH-BKHCZYBLSA-N |
| SMILES | O=C(NN=Cc1c(O)ccc2ccccc12)C(=O)NN=Cc1c(O)ccc2ccccc12 |
|
~%
Ethanedioicacid... CAS#:63968-59-2 |
| Literature: Chanu; Kumar; Lemtur; Lal Spectrochimica Acta - Part A: Molecular and Biomolecular Spectroscopy, 2012 , vol. 96, p. 854 - 861 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |