N-(4-phenylbutan-2-yl)-2-[[2-(4-phenylbutan-2-ylcarbamoyl)phenyl]disulfanyl]benzamide structure
|
Common Name | N-(4-phenylbutan-2-yl)-2-[[2-(4-phenylbutan-2-ylcarbamoyl)phenyl]disulfanyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 63956-36-5 | Molecular Weight | 568.79200 | |
| Density | 1.21g/cm3 | Boiling Point | 746.4ºC at 760mmHg | |
| Molecular Formula | C34H36N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 405.2ºC | |
| Name | N-(4-phenylbutan-2-yl)-2-[[2-(4-phenylbutan-2-ylcarbamoyl)phenyl]disulfanyl]benzamide |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 746.4ºC at 760mmHg |
| Molecular Formula | C34H36N2O2S2 |
| Molecular Weight | 568.79200 |
| Flash Point | 405.2ºC |
| Exact Mass | 568.22200 |
| PSA | 115.78000 |
| LogP | 9.13780 |
| Index of Refraction | 1.651 |
| InChIKey | XADJRNJADYWMBT-UHFFFAOYSA-N |
| SMILES | CC(CCc1ccccc1)NC(=O)c1ccccc1SSc1ccccc1C(=O)NC(C)CCc1ccccc1 |
|
~87%
N-(4-phenylbuta... CAS#:63956-36-5 |
| Literature: Okachi, Ryo; Niino, Hideki; Kitaura, Kozo; Mineura, Kazuyuki; Nakamizo, Yoshinobu; et al. Journal of Medicinal Chemistry, 1985 , vol. 28, # 12 p. 1772 - 1779 |
|
~%
N-(4-phenylbuta... CAS#:63956-36-5 |
| Literature: Okachi, Ryo; Niino, Hideki; Kitaura, Kozo; Mineura, Kazuyuki; Nakamizo, Yoshinobu; et al. Journal of Medicinal Chemistry, 1985 , vol. 28, # 12 p. 1772 - 1779 |