1-Boc-4-[(4-chlorophenyl)hydroxyMethyl]piperidine structure
|
Common Name | 1-Boc-4-[(4-chlorophenyl)hydroxyMethyl]piperidine | ||
|---|---|---|---|---|
| CAS Number | 639468-65-8 | Molecular Weight | 325.83000 | |
| Density | 1.193g/cm3 | Boiling Point | 439.659ºC at 760 mmHg | |
| Molecular Formula | C17H24ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.698ºC | |
| Name | tert-butyl 4-[(4-chlorophenyl)-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 439.659ºC at 760 mmHg |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.83000 |
| Flash Point | 219.698ºC |
| Exact Mass | 325.14400 |
| PSA | 49.77000 |
| LogP | 3.95840 |
| Index of Refraction | 1.55 |
| InChIKey | UAYISMIQJYNJAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD26389242 |