ethyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate
Modify Date: 2025-10-05 09:29:40
ethyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate structure
|
Common Name | ethyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 63935-25-1 | Molecular Weight | 303.18100 | |
| Density | 1.28g/cm3 | Boiling Point | 385.7ºC at 760mmHg | |
| Molecular Formula | C14H16Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | ethyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 385.7ºC at 760mmHg |
| Molecular Formula | C14H16Cl2O3 |
| Molecular Weight | 303.18100 |
| Flash Point | 147.4ºC |
| Exact Mass | 302.04800 |
| PSA | 35.53000 |
| LogP | 3.46380 |
| Index of Refraction | 1.55 |
| InChIKey | HVWFAJJXMGGVPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccc(OCC)cc2)CC1(Cl)Cl |
|
~%
ethyl 2,2-dichl... CAS#:63935-25-1 |
| Literature: Commonwealth Scientific and Industrial Research Organization Patent: US4220591 A1, 1980 ; |
