2,4-Dichloro-7-methoxy-10H-pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine
Modify Date: 2025-11-28 19:12:31
![2,4-Dichloro-7-methoxy-10H-pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine Structure](https://image.chemsrc.com/caspic/393/63931-17-9.png)
2,4-Dichloro-7-methoxy-10H-pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine structure
|
Common Name | 2,4-Dichloro-7-methoxy-10H-pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine | ||
|---|---|---|---|---|
| CAS Number | 63931-17-9 | Molecular Weight | 301.15200 | |
| Density | 1.592g/cm3 | Boiling Point | 494.4ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
| Name | 2,4-Dichloro-7-methoxy-10H-pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 494.4ºC at 760 mmHg |
| Molecular Formula | C10H6Cl2N4OS |
| Molecular Weight | 301.15200 |
| Flash Point | 252.8ºC |
| Exact Mass | 299.96400 |
| PSA | 88.46000 |
| LogP | 3.69 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | SLGIRQPKZQHNKY-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(n1)Sc1c(Cl)nc(Cl)nc1N2 |
|
~%
2,4-Dichloro-7-... CAS#:63931-17-9 |
| Literature: Okafor,C.O. et al. European Journal of Medicinal Chemistry, 1977 , vol. 12, p. 249 - 256 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 10H-Pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine, 2,4-dichloro-7-methoxy- |
| 2,4-Dichloro-7-methoxy-10H-pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazine |