2-chloroethyl-ethyl-[2-(3-ethylphenoxy)ethyl]azanium,chloride
Modify Date: 2025-09-26 01:28:22
![2-chloroethyl-ethyl-[2-(3-ethylphenoxy)ethyl]azanium,chloride Structure](https://image.chemsrc.com/caspic/037/63917-90-8.png)
2-chloroethyl-ethyl-[2-(3-ethylphenoxy)ethyl]azanium,chloride structure
|
Common Name | 2-chloroethyl-ethyl-[2-(3-ethylphenoxy)ethyl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63917-90-8 | Molecular Weight | 292.24500 | |
| Density | N/A | Boiling Point | 321.5ºC at 760 mmHg | |
| Molecular Formula | C14H23Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.2ºC | |
| Name | 2-chloroethyl-ethyl-[2-(3-ethylphenoxy)ethyl]azanium,chloride |
|---|
| Boiling Point | 321.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H23Cl2NO |
| Molecular Weight | 292.24500 |
| Flash Point | 148.2ºC |
| Exact Mass | 291.11600 |
| PSA | 12.47000 |
| LogP | 3.99050 |
| InChIKey | GKJZVPXYCWSVCE-UHFFFAOYSA-N |
| SMILES | CCc1cccc(OCC[NH+](CC)CCCl)c1.[Cl-] |
|
~%
2-chloroethyl-e... CAS#:63917-90-8 |
| Literature: Gump; Nikawitz Journal of the American Chemical Society, 1950 , vol. 72, p. 3846,3848, 3850 |
|
~%
2-chloroethyl-e... CAS#:63917-90-8 |
| Literature: Gump; Nikawitz Journal of the American Chemical Society, 1950 , vol. 72, p. 3846,3848, 3850 |
