2-(Chlorosulfonyl)benzoic acid
Modify Date: 2025-08-20 18:24:19
2-(Chlorosulfonyl)benzoic acid structure
|
Common Name | 2-(Chlorosulfonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 63914-81-8 | Molecular Weight | 220.630 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 384.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H5ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.1±23.2 °C | |
| Name | 2-chlorosulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.0±25.0 °C at 760 mmHg |
| Molecular Formula | C7H5ClO4S |
| Molecular Weight | 220.630 |
| Flash Point | 186.1±23.2 °C |
| Exact Mass | 219.959702 |
| PSA | 79.82000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | ZRWICZHXYMHBDP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Cl |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:121-53-9| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(Chlorosulfonyl)benzoic acid |
| chlorosulfonyl-benzoic acid |
| chlorosulphonyl-benzoic acid |
| 2-Chlorsulfonyl-benzoesaeure |
| Benzoic acid, 2-(chlorosulfonyl)- |
| 2-chlorosulfonyl benzoic acid |
| 2-chloranylsulfonylbenzoic acid |