1-isoamyl-3-isobutylxanthine structure
|
Common Name | 1-isoamyl-3-isobutylxanthine | ||
|---|---|---|---|---|
| CAS Number | 63908-26-9 | Molecular Weight | 278.35000 | |
| Density | 1.153g/cm3 | Boiling Point | 470.5ºC at 760mmHg | |
| Molecular Formula | C14H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.3ºC | |
| Name | 1-(3-methylbutyl)-3-(2-methylpropyl)-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760mmHg |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.35000 |
| Flash Point | 238.3ºC |
| Exact Mass | 278.17400 |
| PSA | 72.68000 |
| LogP | 1.58840 |
| Index of Refraction | 1.537 |
| InChIKey | HRWQHFZQHIUCCC-UHFFFAOYSA-N |
| SMILES | CC(C)CCn1c(=O)c2[nH]cnc2n(CC(C)C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Isobutyl-1-isoamylxanthine |
| 1-Isoamyl-3-isobutylxanthine |
| UNII-976SW405SB |