5-ethoxy-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium,chloride structure
|
Common Name | 5-ethoxy-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63905-71-5 | Molecular Weight | 243.73000 | |
| Density | N/A | Boiling Point | 338.1ºC at 760mmHg | |
| Molecular Formula | C12H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9ºC | |
| Name | 5-ethoxy-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 338.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73000 |
| Flash Point | 135.9ºC |
| Exact Mass | 243.10300 |
| PSA | 30.49000 |
| LogP | 2.87040 |
| InChIKey | YIXDGTNNJMJRDX-UHFFFAOYSA-N |
| SMILES | CCOc1c(OC)ccc2c1CC[NH2+]C2.[Cl-] |
|
~%
5-ethoxy-6-meth... CAS#:63905-71-5 |
| Literature: Ide; Buck Journal of the American Chemical Society, 1937 , vol. 59, p. 726,727 |
|
~%
5-ethoxy-6-meth... CAS#:63905-71-5 |
| Literature: Ide; Buck Journal of the American Chemical Society, 1937 , vol. 59, p. 726,727 |
|
~%
5-ethoxy-6-meth... CAS#:63905-71-5 |
| Literature: Ide; Buck Journal of the American Chemical Society, 1937 , vol. 59, p. 726,727 |
| ISOQUINOLINE,5-ETHOXY-6-METHOXY-1,2,3,4-TETRAHYDRO-,HYDROCHLORIDE |
| 5-Ethoxy-6-methoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride |
| 5-ethoxy-6-methoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride |
| 5-ethoxy-6-methoxy-1,2,3,4-tetrahydroisoquinolinium chloride |