4-Hydrazino-2-methyl-5-methylsulfonyl-3(2H)-pyridazinone structure
|
Common Name | 4-Hydrazino-2-methyl-5-methylsulfonyl-3(2H)-pyridazinone | ||
|---|---|---|---|---|
| CAS Number | 63901-43-9 | Molecular Weight | 218.23400 | |
| Density | 1.63g/cm3 | Boiling Point | 434.6ºC at 760mmHg | |
| Molecular Formula | C6H10N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 4-hydrazinyl-2-methyl-5-methylsulfonylpyridazin-3-one |
|---|
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760mmHg |
| Molecular Formula | C6H10N4O3S |
| Molecular Weight | 218.23400 |
| Flash Point | 216.7ºC |
| Exact Mass | 218.04700 |
| PSA | 115.46000 |
| LogP | 0.32350 |
| Index of Refraction | 1.669 |
| InChIKey | DFUKIRXEWZNITQ-UHFFFAOYSA-N |
| SMILES | Cn1ncc(S(C)(=O)=O)c(NN)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |