Albasapogenin structure
|
Common Name | Albasapogenin | ||
|---|---|---|---|---|
| CAS Number | 639-14-5 | Molecular Weight | 470.68 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 581.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.3±26.6 °C | |
Use of AlbasapogeninGypsogenin shows antiangiogenic activity and the significant cytotoxicity against H460[1]. |
| Name | gypsogenin |
|---|---|
| Synonym | More Synonyms |
| Description | Gypsogenin shows antiangiogenic activity and the significant cytotoxicity against H460[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Xie LX, et al. Two new triterpenoids from Gypsophila oldhamiana. Nat Prod Res. 2016;30(9):1068-1074. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.1±50.0 °C at 760 mmHg |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.68 |
| Flash Point | 319.3±26.6 °C |
| Exact Mass | 470.339600 |
| PSA | 74.60000 |
| LogP | 7.56 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | QMHCWDVPABYZMC-MYPRUECHSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C=O)C5CCC43C)C2C1 |
| Storage condition | 2-8℃ |
| (3β)-3-Hydroxy-23-oxoolean-12-en-28-oic acid |
| Astrantiagenin D |
| 3beta-hydroxy-23-oxoolean-12-en-28-oic acid |
| Githagenin |
| Gypsophilasapogenin |
| Albsapogenin |
| (3b,4a)-3-Hydroxy-23-oxoolean-12-en-28-oic Acid |
| Gypsogenin |
| Olean-12-en-28-oic acid, 3-hydroxy-23-oxo-, (3β)- |
| EINECS 211-353-7 |
| Saponin-gypsophila |
| Gypsophilasaponin |
| Albasapogenin |
| (4aS,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-9-formyl-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |