2-Hydroxy-6-[2-(4-hydroxyphenyl)ethyl]benzoic acid Methyl ester
Modify Date: 2025-09-29 13:54:31
![2-Hydroxy-6-[2-(4-hydroxyphenyl)ethyl]benzoic acid Methyl ester Structure](https://image.chemsrc.com/caspic/378/63898-00-0.png)
2-Hydroxy-6-[2-(4-hydroxyphenyl)ethyl]benzoic acid Methyl ester structure
|
Common Name | 2-Hydroxy-6-[2-(4-hydroxyphenyl)ethyl]benzoic acid Methyl ester | ||
|---|---|---|---|---|
| CAS Number | 63898-00-0 | Molecular Weight | 272.29600 | |
| Density | 1.251g/cm3 | Boiling Point | 429.393ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.966ºC | |
| Name | Methyl 2-hydroxy-6-[2-(4-hydroxyphenyl)ethyl]benzoate |
|---|
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 429.393ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 157.966ºC |
| Exact Mass | 272.10500 |
| PSA | 66.76000 |
| LogP | 2.66960 |
| Index of Refraction | 1.613 |
| InChIKey | JBLUWOHBXBPOKU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(O)cccc1CCc1ccc(O)cc1 |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |