N-Cyclohexyl-2-(allyloxy)benzamide
Modify Date: 2024-09-17 18:33:02
N-Cyclohexyl-2-(allyloxy)benzamide structure
|
Common Name | N-Cyclohexyl-2-(allyloxy)benzamide | ||
|---|---|---|---|---|
| CAS Number | 63887-50-3 | Molecular Weight | 259.34300 | |
| Density | 1.07g/cm3 | Boiling Point | 428.6ºC at 760 mmHg | |
| Molecular Formula | C16H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | N-cyclohexyl-2-prop-2-enoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760 mmHg |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.34300 |
| Flash Point | 213ºC |
| Exact Mass | 259.15700 |
| PSA | 41.82000 |
| LogP | 3.88870 |
| Index of Refraction | 1.543 |
| InChIKey | UYODDCKMZFCTPB-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccccc1C(=O)NC1CCCCC1 |
|
~%
N-Cyclohexyl-2-... CAS#:63887-50-3 |
| Literature: Faust et al. Journal of the American Pharmaceutical Association (1912-1977), 1956 , vol. 45, p. 514,517 |
| o-Allyloxy-N-cyclohexylbenzamide |
| BENZAMIDE,o-ALLYLOXY-N-CYCLOHEXYL |