3H-Phenoxazine-1,9-dicarboxamide,2-amino-N1,N9-bis[2-(4-methoxyphenyl)ethyl]-4,6-dimethyl-3-oxo- structure
|
Common Name | 3H-Phenoxazine-1,9-dicarboxamide,2-amino-N1,N9-bis[2-(4-methoxyphenyl)ethyl]-4,6-dimethyl-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 63879-44-7 | Molecular Weight | 594.65700 | |
| Density | 1.3g/cm3 | Boiling Point | 785ºC at 760mmHg | |
| Molecular Formula | C34H34N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 428.6ºC | |
| Name | 2-amino-1-N,9-N-bis[2-(4-methoxyphenyl)ethyl]-4,6-dimethyl-3-oxophenoxazine-1,9-dicarboxamide |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 785ºC at 760mmHg |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.65700 |
| Flash Point | 428.6ºC |
| Exact Mass | 594.24800 |
| PSA | 145.78000 |
| LogP | 5.81700 |
| Index of Refraction | 1.638 |
| InChIKey | SPXDFBWNQGMYSU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)c2c3nc4c(C(=O)NCCc5ccc(OC)cc5)ccc(C)c4oc-3c(C)c(=O)c2N)cc1 |
|
~%
3H-Phenoxazine-... CAS#:63879-44-7 |
| Literature: Jain,P.C. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 163 - 164 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |