2-amino-4,6-dimethyl-3-oxo-N,N-bis[2-(4-phenylpiperazin-1-yl)ethyl]phenoxazine-1,9-dicarboxamide structure
|
Common Name | 2-amino-4,6-dimethyl-3-oxo-N,N-bis[2-(4-phenylpiperazin-1-yl)ethyl]phenoxazine-1,9-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 63879-41-4 | Molecular Weight | 702.84400 | |
| Density | 1.33g/cm3 | Boiling Point | 870ºC at 760 mmHg | |
| Molecular Formula | C40H46N8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 480ºC | |
| Name | 2-amino-4,6-dimethyl-3-oxo-N1,N9-bis(2-(4-phenylpiperazin-1-yl)ethyl)-3H-phenoxazine-1,9-dicarboxamide |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 870ºC at 760 mmHg |
| Molecular Formula | C40H46N8O4 |
| Molecular Weight | 702.84400 |
| Flash Point | 480ºC |
| Exact Mass | 702.36400 |
| PSA | 140.28000 |
| LogP | 4.96460 |
| Index of Refraction | 1.683 |
| InChIKey | KECMICZSONPIAB-UHFFFAOYSA-N |
| SMILES | Cc1c2oc3c(C)ccc(C(=O)NCCN4CCN(c5ccccc5)CC4)c3nc-2c(C(=O)NCCN2CCN(c3ccccc3)CC2)c(N)c1=O |
|
~%
2-amino-4,6-dim... CAS#:63879-41-4 |
| Literature: Jain,P.C. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 163 - 164 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |